C8H16N4O3 — CID 43374719
N-(2-aminoethyl)-N'-methyl-N'-[2-(methylamino)-2-oxoethyl]oxamide (PubChem CID 43374719) has the molecular formula C8H16N4O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-methyl-N'-[2-(methylamino)-2-oxoethyl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-methyl-N'-[2-(methylamino)-2-oxoethyl]oxamide |
|---|---|
| PubChem CID | 43374719 |
| Molecular Formula | C8H16N4O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | N-(2-aminoethyl)-N'-methyl-N'-[2-(methylamino)-2-oxoethyl]oxamide |
| SMILES | CNC(=O)CN(C)C(=O)C(=O)NCCN |
| InChI | InChI=1S/C8H16N4O3/c1-10-6(13)5-12(2)8(15)7(14)11-4-3-9/h3-5,9H2,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | LJSKPHYRHZFBLZ-UHFFFAOYSA-N |
| XLogP | -2.73 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | -2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|