C10H20N4O3 — CID 55000373
N-(2-aminoethyl)-N'-methyl-N'-[2-oxo-2-(propan-2-ylamino)ethyl]oxamide (PubChem CID 55000373) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-(2-aminoethyl)-N'-methyl-N'-[2-oxo-2-(propan-2-ylamino)ethyl]oxamide.
| Compound Name | N-(2-aminoethyl)-N'-methyl-N'-[2-oxo-2-(propan-2-ylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 55000373 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N-(2-aminoethyl)-N'-methyl-N'-[2-oxo-2-(propan-2-ylamino)ethyl]oxamide |
| SMILES | CC(C)NC(=O)CN(C)C(=O)C(=O)NCCN |
| InChI | InChI=1S/C10H20N4O3/c1-7(2)13-8(15)6-14(3)10(17)9(16)12-5-4-11/h7H,4-6,11H2,1-3H3,(H,12,16)(H,13,15) |
| InChIKey | GSXPJHGRWGJLJD-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|