C10H16N2O4 — CID 76991328
2,3-dimethyl-4-[methyl-[2-(methylamino)-2-oxoethyl]amino]-4-oxobut-2-enoic acid (PubChem CID 76991328) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2,3-dimethyl-4-[methyl-[2-(methylamino)-2-oxoethyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 2,3-dimethyl-4-[methyl-[2-(methylamino)-2-oxoethyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76991328 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2,3-dimethyl-4-[methyl-[2-(methylamino)-2-oxoethyl]amino]-4-oxobut-2-enoic acid |
| SMILES | CNC(=O)CN(C)C(=O)C(C)=C(C)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-6(7(2)10(15)16)9(14)12(4)5-8(13)11-3/h5H2,1-4H3,(H,11,13)(H,15,16) |
| InChIKey | FXZQICFSJVHSLP-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|