C11H9ClN4O2S — CID 107198513
5-amino-3-chloro-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzamide (PubChem CID 107198513) has the molecular formula C11H9ClN4O2S and a molecular weight of 296.74 g/mol. Its IUPAC name is 5-amino-3-chloro-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzamide.
| Compound Name | 5-amino-3-chloro-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 107198513 |
| Molecular Formula | C11H9ClN4O2S |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 5-amino-3-chloro-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzamide |
| SMILES | NC(=O)c1cc(N)cc(Cl)c1Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C11H9ClN4O2S/c12-7-4-5(13)3-6(10(14)18)9(7)19-11-15-2-1-8(17)16-11/h1-4H,13H2,(H2,14,18)(H,15,16,17) |
| InChIKey | NAPYXEXHUZKRQC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|