C13H12ClN3O3S — CID 107198511
ethyl 5-amino-3-chloro-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzoate (PubChem CID 107198511) has the molecular formula C13H12ClN3O3S and a molecular weight of 325.78 g/mol. Its IUPAC name is ethyl 5-amino-3-chloro-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzoate.
| Compound Name | ethyl 5-amino-3-chloro-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzoate |
|---|---|
| PubChem CID | 107198511 |
| Molecular Formula | C13H12ClN3O3S |
| Molecular Weight | 325.78 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | ethyl 5-amino-3-chloro-2-[(6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzoate |
| SMILES | CCOC(=O)c1cc(N)cc(Cl)c1Sc1nccc(=O)[nH]1 |
| InChI | InChI=1S/C13H12ClN3O3S/c1-2-20-12(19)8-5-7(15)6-9(14)11(8)21-13-16-4-3-10(18)17-13/h3-6H,2,15H2,1H3,(H,16,17,18) |
| InChIKey | PJGQSAIAXMKGAI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.78 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|