C12H12ClN3O2S2 — CID 107198820
ethyl 5-amino-3-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzoate (PubChem CID 107198820) has the molecular formula C12H12ClN3O2S2 and a molecular weight of 329.83 g/mol. Its IUPAC name is ethyl 5-amino-3-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzoate.
| Compound Name | ethyl 5-amino-3-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzoate |
|---|---|
| PubChem CID | 107198820 |
| Molecular Formula | C12H12ClN3O2S2 |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | ethyl 5-amino-3-chloro-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzoate |
| SMILES | CCOC(=O)c1cc(N)cc(Cl)c1Sc1nc(C)ns1 |
| InChI | InChI=1S/C12H12ClN3O2S2/c1-3-18-11(17)8-4-7(14)5-9(13)10(8)19-12-15-6(2)16-20-12/h4-5H,3,14H2,1-2H3 |
| InChIKey | AQDUEQLSSSZREK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|