C10H10N4OS2 — CID 112580243
3-amino-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzamide (PubChem CID 112580243) has the molecular formula C10H10N4OS2 and a molecular weight of 266.35 g/mol. Its IUPAC name is 3-amino-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzamide.
| Compound Name | 3-amino-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzamide |
|---|---|
| PubChem CID | 112580243 |
| Molecular Formula | C10H10N4OS2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 3-amino-2-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanyl]benzamide |
| SMILES | Cc1nsc(Sc2c(N)cccc2C(N)=O)n1 |
| InChI | InChI=1S/C10H10N4OS2/c1-5-13-10(17-14-5)16-8-6(9(12)15)3-2-4-7(8)11/h2-4H,11H2,1H3,(H2,12,15) |
| InChIKey | WVTNXXZWMSCPDS-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|