C11H13N5OS2 — CID 112580185
3-amino-2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]benzamide (PubChem CID 112580185) has the molecular formula C11H13N5OS2 and a molecular weight of 295.39 g/mol. Its IUPAC name is 3-amino-2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]benzamide.
| Compound Name | 3-amino-2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]benzamide |
|---|---|
| PubChem CID | 112580185 |
| Molecular Formula | C11H13N5OS2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-amino-2-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]benzamide |
| SMILES | CN(C)c1nnc(Sc2c(N)cccc2C(N)=O)s1 |
| InChI | InChI=1S/C11H13N5OS2/c1-16(2)10-14-15-11(19-10)18-8-6(9(13)17)4-3-5-7(8)12/h3-5H,12H2,1-2H3,(H2,13,17) |
| InChIKey | LQDYWXGTXDGBIT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|