About N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide
N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide (PubChem CID 107199408) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide |
| PubChem CID | 107199408 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide |
| SMILES | CC1CNCC1C(=O)N(C)CCCCCO |
| InChI | InChI=1S/C12H24N2O2/c1-10-8-13-9-11(10)12(16)14(2)6-4-3-5-7-15/h10-11,13,15H,3-9H2,1-2H3 |
| InChIKey | BJOGOXZIEJOBFJ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide?
The IUPAC name of N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide (CID 107199408) is N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide.
What is the SMILES notation for N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide?
The canonical SMILES for N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide is CC1CNCC1C(=O)N(C)CCCCCO.
What is the InChIKey of N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide?
The InChIKey is BJOGOXZIEJOBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-10-8-13-9-11(10)12(16)14(2)6-4-3-5-7-15/h10-11,13,15H,3-9H2,1-2H3.
What are the key properties of N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide?
N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide has a molecular weight of 228.34 g/mol, XLogP of 0.46, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-hydroxypentyl)-N,4-dimethylpyrrolidine-3-carboxamide is sourced from PubChem (CID 107199408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).