C15H22N4O2 — CID 107202135
N-(5-hydroxypentyl)-N,1-dimethyl-5-pyrrol-1-ylpyrazole-4-carboxamide (PubChem CID 107202135) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-N,1-dimethyl-5-pyrrol-1-ylpyrazole-4-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-N,1-dimethyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 107202135 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-(5-hydroxypentyl)-N,1-dimethyl-5-pyrrol-1-ylpyrazole-4-carboxamide |
| SMILES | CN(CCCCCO)C(=O)c1cnn(C)c1-n1cccc1 |
| InChI | InChI=1S/C15H22N4O2/c1-17(8-4-3-7-11-20)15(21)13-12-16-18(2)14(13)19-9-5-6-10-19/h5-6,9-10,12,20H,3-4,7-8,11H2,1-2H3 |
| InChIKey | RYJPNMGOAHJBOQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|