C15H20N2O2S — CID 126820059
N-(4-hydroxybutyl)-N,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide (PubChem CID 126820059) has the molecular formula C15H20N2O2S and a molecular weight of 292.40 g/mol. Its IUPAC name is N-(4-hydroxybutyl)-N,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide.
| Compound Name | N-(4-hydroxybutyl)-N,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 126820059 |
| Molecular Formula | C15H20N2O2S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-(4-hydroxybutyl)-N,5-dimethyl-2-pyrrol-1-ylthiophene-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)CCCCO)c(-n2cccc2)s1 |
| InChI | InChI=1S/C15H20N2O2S/c1-12-11-13(14(19)16(2)7-5-6-10-18)15(20-12)17-8-3-4-9-17/h3-4,8-9,11,18H,5-7,10H2,1-2H3 |
| InChIKey | YDSHTMTUUHVSNC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|