C15H20ClN3O2 — CID 107203975
7-chloro-2-[[5-hydroxypentyl(methyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 107203975) has the molecular formula C15H20ClN3O2 and a molecular weight of 309.80 g/mol. Its IUPAC name is 7-chloro-2-[[5-hydroxypentyl(methyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-chloro-2-[[5-hydroxypentyl(methyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 107203975 |
| Molecular Formula | C15H20ClN3O2 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 7-chloro-2-[[5-hydroxypentyl(methyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | CN(CCCCCO)Cc1cc(=O)n2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C15H20ClN3O2/c1-18(7-3-2-4-8-20)11-13-9-15(21)19-10-12(16)5-6-14(19)17-13/h5-6,9-10,20H,2-4,7-8,11H2,1H3 |
| InChIKey | BJBUVLIQDOILFV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|