C16H20ClN3O2 — CID 111431994
7-chloro-2-[[cyclopropyl(4-hydroxybutyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one (PubChem CID 111431994) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 7-chloro-2-[[cyclopropyl(4-hydroxybutyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 7-chloro-2-[[cyclopropyl(4-hydroxybutyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 111431994 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 7-chloro-2-[[cyclopropyl(4-hydroxybutyl)amino]methyl]pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1cc(CN(CCCCO)C2CC2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C16H20ClN3O2/c17-12-3-6-15-18-13(9-16(22)20(15)10-12)11-19(14-4-5-14)7-1-2-8-21/h3,6,9-10,14,21H,1-2,4-5,7-8,11H2 |
| InChIKey | WTZQZLKNXWWSJZ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|