C12H18ClNO2 — CID 107205486
N-(5-chloropentyl)-N,2-dimethylfuran-3-carboxamide (PubChem CID 107205486) has the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. Its IUPAC name is N-(5-chloropentyl)-N,2-dimethylfuran-3-carboxamide.
| Compound Name | N-(5-chloropentyl)-N,2-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 107205486 |
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | N-(5-chloropentyl)-N,2-dimethylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)N(C)CCCCCCl |
| InChI | InChI=1S/C12H18ClNO2/c1-10-11(6-9-16-10)12(15)14(2)8-5-3-4-7-13/h6,9H,3-5,7-8H2,1-2H3 |
| InChIKey | UOHIRFBPDVPKFO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.73 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|