C13H20N2O3 — CID 56758649
N-[2-(butylamino)-2-oxoethyl]-N,2-dimethylfuran-3-carboxamide (PubChem CID 56758649) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is N-[2-(butylamino)-2-oxoethyl]-N,2-dimethylfuran-3-carboxamide.
| Compound Name | N-[2-(butylamino)-2-oxoethyl]-N,2-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 56758649 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | N-[2-(butylamino)-2-oxoethyl]-N,2-dimethylfuran-3-carboxamide |
| SMILES | CCCCNC(=O)CN(C)C(=O)c1ccoc1C |
| InChI | InChI=1S/C13H20N2O3/c1-4-5-7-14-12(16)9-15(3)13(17)11-6-8-18-10(11)2/h6,8H,4-5,7,9H2,1-3H3,(H,14,16) |
| InChIKey | HKYSNJFUTHFBSM-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|