C11H15BrN2O4 — CID 106853533
2-bromo-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N-methylfuran-3-carboxamide (PubChem CID 106853533) has the molecular formula C11H15BrN2O4 and a molecular weight of 319.16 g/mol. Its IUPAC name is 2-bromo-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N-methylfuran-3-carboxamide.
| Compound Name | 2-bromo-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 106853533 |
| Molecular Formula | C11H15BrN2O4 |
| Molecular Weight | 319.16 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 2-bromo-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N-methylfuran-3-carboxamide |
| SMILES | COCCNC(=O)CN(C)C(=O)c1ccoc1Br |
| InChI | InChI=1S/C11H15BrN2O4/c1-14(7-9(15)13-4-6-17-2)11(16)8-3-5-18-10(8)12/h3,5H,4,6-7H2,1-2H3,(H,13,15) |
| InChIKey | BHMRVYKEQLPKKH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.16 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|