C14H20BrN3O3 — CID 107872407
3-amino-5-bromo-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,2-dimethylbenzamide (PubChem CID 107872407) has the molecular formula C14H20BrN3O3 and a molecular weight of 358.24 g/mol. Its IUPAC name is 3-amino-5-bromo-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,2-dimethylbenzamide.
| Compound Name | 3-amino-5-bromo-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 107872407 |
| Molecular Formula | C14H20BrN3O3 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 3-amino-5-bromo-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,2-dimethylbenzamide |
| SMILES | COCCNC(=O)CN(C)C(=O)c1cc(Br)cc(N)c1C |
| InChI | InChI=1S/C14H20BrN3O3/c1-9-11(6-10(15)7-12(9)16)14(20)18(2)8-13(19)17-4-5-21-3/h6-7H,4-5,8,16H2,1-3H3,(H,17,19) |
| InChIKey | SMGSRPDCMNGWTQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|