C14H19ClN2O3 — CID 84589607
2-chloro-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,3-dimethylbenzamide (PubChem CID 84589607) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-chloro-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,3-dimethylbenzamide.
| Compound Name | 2-chloro-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 84589607 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-chloro-N-[2-(2-methoxyethylamino)-2-oxoethyl]-N,3-dimethylbenzamide |
| SMILES | COCCNC(=O)CN(C)C(=O)c1cccc(C)c1Cl |
| InChI | InChI=1S/C14H19ClN2O3/c1-10-5-4-6-11(13(10)15)14(19)17(2)9-12(18)16-7-8-20-3/h4-6H,7-9H2,1-3H3,(H,16,18) |
| InChIKey | KTVUXSVCXHPMEF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|