C30H47N5O6 — CID 10721836
(2S)-2-[[(2S)-2-(3,3-dimethylbutanoylamino)-3,3-dimethylbutanoyl]amino]-N-[3,4-dioxo-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]-N',N'-dimethylbutanediamide (PubChem CID 10721836) has the molecular formula C30H47N5O6 and a molecular weight of 573.74 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(3,3-dimethylbutanoylamino)-3,3-dimethylbutanoyl]amino]-N-[3,4-dioxo-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]-N',N'-dimethylbutanediamide.
| Compound Name | (2S)-2-[[(2S)-2-(3,3-dimethylbutanoylamino)-3,3-dimethylbutanoyl]amino]-N-[3,4-dioxo-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]-N',N'-dimethylbutanediamide |
|---|---|
| PubChem CID | 10721836 |
| Molecular Formula | C30H47N5O6 |
| Molecular Weight | 573.74 g/mol |
| Exact Mass | 573.35 |
| IUPAC Name | (2S)-2-[[(2S)-2-(3,3-dimethylbutanoylamino)-3,3-dimethylbutanoyl]amino]-N-[3,4-dioxo-4-[[(1S)-1-phenylethyl]amino]butan-2-yl]-N',N'-dimethylbutanediamide |
| SMILES | CC(NC(=O)[C@H](CC(=O)N(C)C)NC(=O)[C@@H](NC(=O)CC(C)(C)C)C(C)(C)C)C(=O)C(=O)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C30H47N5O6/c1-18(20-14-12-11-13-15-20)31-27(40)24(38)19(2)32-26(39)21(16-23(37)35(9)10)33-28(41)25(30(6,7)8)34-22(36)17-29(3,4)5/h11-15,18-19,21,25H,16-17H2,1-10H3,(H,31,40)(H,32,39)(H,33,41)(H,34,36)/t18-,19?,21-,25+/m0/s1 |
| InChIKey | YRRJUHCZUVWGHX-VOPJJNMMSA-N |
| XLogP | 1.87 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.74 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|