C20H32N2O2 — CID 42703986
2-(3,3-dimethylbutanoylamino)-3-methyl-N-(1-phenylethyl)pentanamide (PubChem CID 42703986) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 2-(3,3-dimethylbutanoylamino)-3-methyl-N-(1-phenylethyl)pentanamide.
| Compound Name | 2-(3,3-dimethylbutanoylamino)-3-methyl-N-(1-phenylethyl)pentanamide |
|---|---|
| PubChem CID | 42703986 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 2-(3,3-dimethylbutanoylamino)-3-methyl-N-(1-phenylethyl)pentanamide |
| SMILES | CCC(C)C(NC(=O)CC(C)(C)C)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C20H32N2O2/c1-7-14(2)18(22-17(23)13-20(4,5)6)19(24)21-15(3)16-11-9-8-10-12-16/h8-12,14-15,18H,7,13H2,1-6H3,(H,21,24)(H,22,23) |
| InChIKey | IBAKZHFWCFDEQR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |