C9H20N2O2 — CID 107218468
2-(tert-butylamino)-N-[(2R)-1-hydroxypropan-2-yl]acetamide (PubChem CID 107218468) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-(tert-butylamino)-N-[(2R)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-(tert-butylamino)-N-[(2R)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 107218468 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 2-(tert-butylamino)-N-[(2R)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@H](CO)NC(=O)CNC(C)(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-7(6-12)11-8(13)5-10-9(2,3)4/h7,10,12H,5-6H2,1-4H3,(H,11,13)/t7-/m1/s1 |
| InChIKey | KMKFBUAVTOUIOV-SSDOTTSWSA-N |
| XLogP | -0.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |