C13H17ClN4O — CID 107224069
2-chloro-6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyridine-4-carbonitrile (PubChem CID 107224069) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is 2-chloro-6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyridine-4-carbonitrile.
| Compound Name | 2-chloro-6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107224069 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-chloro-6-[4-(2-hydroxyethyl)-1,4-diazepan-1-yl]pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Cl)nc(N2CCCN(CCO)CC2)c1 |
| InChI | InChI=1S/C13H17ClN4O/c14-12-8-11(10-15)9-13(16-12)18-3-1-2-17(4-5-18)6-7-19/h8-9,19H,1-7H2 |
| InChIKey | NVLAKZUWXMGOQO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 63.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|