C11H23N3O — CID 107226623
2-(4-butanimidoyl-1,4-diazepan-1-yl)ethanol (PubChem CID 107226623) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-(4-butanimidoyl-1,4-diazepan-1-yl)ethanol.
| Compound Name | 2-(4-butanimidoyl-1,4-diazepan-1-yl)ethanol |
|---|---|
| PubChem CID | 107226623 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 2-(4-butanimidoyl-1,4-diazepan-1-yl)ethanol |
| SMILES | [H]/N=C(\CCC)N1CCCN(CCO)CC1 |
| InChI | InChI=1S/C11H23N3O/c1-2-4-11(12)14-6-3-5-13(7-8-14)9-10-15/h12,15H,2-10H2,1H3/b12-11+ |
| InChIKey | QTVCGNNLLAPUJI-VAWYXSNFSA-N |
| XLogP | 0.76 |
| TPSA | 50.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|