C37H34ClN2O4P — CID 10722756
[4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl-triphenylphosphanium chloride (PubChem CID 10722756) has the molecular formula C37H34ClN2O4P and a molecular weight of 637.12 g/mol. Its IUPAC name is [4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl-triphenylphosphanium chloride.
| Compound Name | [4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 10722756 |
| Molecular Formula | C37H34ClN2O4P |
| Molecular Weight | 637.12 g/mol |
| Exact Mass | 636.19 |
| IUPAC Name | [4-(3,4-dimethoxyphenyl)-6,7-dimethoxyquinazolin-2-yl]methyl-triphenylphosphanium chloride |
| SMILES | COc1ccc(-c2nc(C[P+](c3ccccc3)(c3ccccc3)c3ccccc3)nc3cc(OC)c(OC)cc23)cc1OC.[Cl-] |
| InChI | InChI=1S/C37H34N2O4P.ClH/c1-40-32-21-20-26(22-33(32)41-2)37-30-23-34(42-3)35(43-4)24-31(30)38-36(39-37)25-44(27-14-8-5-9-15-27,28-16-10-6-11-17-28)29-18-12-7-13-19-29;/h5-24H,25H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HFEWPERTTBCIIV-UHFFFAOYSA-M |
| XLogP | 3.83 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|