C15H24N2O3S — CID 107227828
2-[1-[3-(1-aminoethyl)phenyl]sulfonylpiperidin-3-yl]ethanol (PubChem CID 107227828) has the molecular formula C15H24N2O3S and a molecular weight of 312.44 g/mol. Its IUPAC name is 2-[1-[3-(1-aminoethyl)phenyl]sulfonylpiperidin-3-yl]ethanol.
| Compound Name | 2-[1-[3-(1-aminoethyl)phenyl]sulfonylpiperidin-3-yl]ethanol |
|---|---|
| PubChem CID | 107227828 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-[1-[3-(1-aminoethyl)phenyl]sulfonylpiperidin-3-yl]ethanol |
| SMILES | CC(N)c1cccc(S(=O)(=O)N2CCCC(CCO)C2)c1 |
| InChI | InChI=1S/C15H24N2O3S/c1-12(16)14-5-2-6-15(10-14)21(19,20)17-8-3-4-13(11-17)7-9-18/h2,5-6,10,12-13,18H,3-4,7-9,11,16H2,1H3 |
| InChIKey | NLCYWRWHOUYWRT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |