C17H25N3 — CID 107236413
2-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-dimethylindole (PubChem CID 107236413) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 2-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-dimethylindole.
| Compound Name | 2-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-dimethylindole |
|---|---|
| PubChem CID | 107236413 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 2-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-dimethylindole |
| SMILES | Cc1c(CN2CC(C)NCC2C)n(C)c2ccccc12 |
| InChI | InChI=1S/C17H25N3/c1-12-10-20(13(2)9-18-12)11-17-14(3)15-7-5-6-8-16(15)19(17)4/h5-8,12-13,18H,9-11H2,1-4H3 |
| InChIKey | QSVQLWXRIGTBIQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|