C14H24N4O2 — CID 107237586
tert-butyl N-[2-[(3-ethylimidazol-4-yl)methylamino]cyclopropyl]carbamate (PubChem CID 107237586) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-ethylimidazol-4-yl)methylamino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-ethylimidazol-4-yl)methylamino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107237586 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | tert-butyl N-[2-[(3-ethylimidazol-4-yl)methylamino]cyclopropyl]carbamate |
| SMILES | CCn1cncc1CNC1CC1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24N4O2/c1-5-18-9-15-7-10(18)8-16-11-6-12(11)17-13(19)20-14(2,3)4/h7,9,11-12,16H,5-6,8H2,1-4H3,(H,17,19) |
| InChIKey | HQMYJRMMKBGNQB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |