C16H28N4O2 — CID 107244046
tert-butyl N-[1-cyclopropyl-2-[(3-ethylimidazol-4-yl)methylamino]ethyl]carbamate (PubChem CID 107244046) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is tert-butyl N-[1-cyclopropyl-2-[(3-ethylimidazol-4-yl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[1-cyclopropyl-2-[(3-ethylimidazol-4-yl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 107244046 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | tert-butyl N-[1-cyclopropyl-2-[(3-ethylimidazol-4-yl)methylamino]ethyl]carbamate |
| SMILES | CCn1cncc1CNCC(NC(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C16H28N4O2/c1-5-20-11-18-9-13(20)8-17-10-14(12-6-7-12)19-15(21)22-16(2,3)4/h9,11-12,14,17H,5-8,10H2,1-4H3,(H,19,21) |
| InChIKey | DXJMTAKIUDCPNF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |