C15H28N2O4 — CID 107238131
tert-butyl N-[2-[(3-ethoxy-2-methoxycyclobutyl)amino]cyclopropyl]carbamate (PubChem CID 107238131) has the molecular formula C15H28N2O4 and a molecular weight of 300.40 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-ethoxy-2-methoxycyclobutyl)amino]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-ethoxy-2-methoxycyclobutyl)amino]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 107238131 |
| Molecular Formula | C15H28N2O4 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | tert-butyl N-[2-[(3-ethoxy-2-methoxycyclobutyl)amino]cyclopropyl]carbamate |
| SMILES | CCOC1CC(NC2CC2NC(=O)OC(C)(C)C)C1OC |
| InChI | InChI=1S/C15H28N2O4/c1-6-20-12-8-11(13(12)19-5)16-9-7-10(9)17-14(18)21-15(2,3)4/h9-13,16H,6-8H2,1-5H3,(H,17,18) |
| InChIKey | QLQDCYUXVYMEJH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |