C16H30N2O4S — CID 107255309
tert-butyl N-[3-ethoxy-2-[(1-oxothian-4-yl)amino]cyclobutyl]carbamate (PubChem CID 107255309) has the molecular formula C16H30N2O4S and a molecular weight of 346.49 g/mol. Its IUPAC name is tert-butyl N-[3-ethoxy-2-[(1-oxothian-4-yl)amino]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[3-ethoxy-2-[(1-oxothian-4-yl)amino]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 107255309 |
| Molecular Formula | C16H30N2O4S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | tert-butyl N-[3-ethoxy-2-[(1-oxothian-4-yl)amino]cyclobutyl]carbamate |
| SMILES | CCOC1CC(NC(=O)OC(C)(C)C)C1NC1CCS(=O)CC1 |
| InChI | InChI=1S/C16H30N2O4S/c1-5-21-13-10-12(18-15(19)22-16(2,3)4)14(13)17-11-6-8-23(20)9-7-11/h11-14,17H,5-10H2,1-4H3,(H,18,19) |
| InChIKey | LIZDKLLRUKZMHM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |