C18H28N2O3 — CID 107252787
tert-butyl N-[(E)-4-[1-(4-hydroxyphenyl)propan-2-ylamino]but-2-enyl]carbamate (PubChem CID 107252787) has the molecular formula C18H28N2O3 and a molecular weight of 320.43 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[1-(4-hydroxyphenyl)propan-2-ylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[1-(4-hydroxyphenyl)propan-2-ylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 107252787 |
| Molecular Formula | C18H28N2O3 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | tert-butyl N-[(E)-4-[1-(4-hydroxyphenyl)propan-2-ylamino]but-2-enyl]carbamate |
| SMILES | CC(Cc1ccc(O)cc1)NC/C=C/CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O3/c1-14(13-15-7-9-16(21)10-8-15)19-11-5-6-12-20-17(22)23-18(2,3)4/h5-10,14,19,21H,11-13H2,1-4H3,(H,20,22)/b6-5+ |
| InChIKey | JVXIAPXOXCGQAW-AATRIKPKSA-N |
| XLogP | 2.99 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|