C18H28N2O2 — CID 107253277
tert-butyl N-[(E)-4-[1-(3-methylphenyl)ethylamino]but-2-enyl]carbamate (PubChem CID 107253277) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[1-(3-methylphenyl)ethylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[1-(3-methylphenyl)ethylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 107253277 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | tert-butyl N-[(E)-4-[1-(3-methylphenyl)ethylamino]but-2-enyl]carbamate |
| SMILES | Cc1cccc(C(C)NC/C=C/CNC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C18H28N2O2/c1-14-9-8-10-16(13-14)15(2)19-11-6-7-12-20-17(21)22-18(3,4)5/h6-10,13,15,19H,11-12H2,1-5H3,(H,20,21)/b7-6+ |
| InChIKey | OWEQURXKDFSBSM-VOTSOKGWSA-N |
| XLogP | 3.73 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|