C14H23N3O2S — CID 107253060
tert-butyl N-[(E)-4-[1-(1,3-thiazol-5-yl)ethylamino]but-2-enyl]carbamate (PubChem CID 107253060) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[1-(1,3-thiazol-5-yl)ethylamino]but-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[1-(1,3-thiazol-5-yl)ethylamino]but-2-enyl]carbamate |
|---|---|
| PubChem CID | 107253060 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | tert-butyl N-[(E)-4-[1-(1,3-thiazol-5-yl)ethylamino]but-2-enyl]carbamate |
| SMILES | CC(NC/C=C/CNC(=O)OC(C)(C)C)c1cncs1 |
| InChI | InChI=1S/C14H23N3O2S/c1-11(12-9-15-10-20-12)16-7-5-6-8-17-13(18)19-14(2,3)4/h5-6,9-11,16H,7-8H2,1-4H3,(H,17,18)/b6-5+ |
| InChIKey | RXQIDGITFNOESI-AATRIKPKSA-N |
| XLogP | 2.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|