C13H17FN4O — CID 107259623
2-fluoro-1-N-[3-(1H-imidazol-2-yl)propyl]-5-methoxybenzene-1,4-diamine (PubChem CID 107259623) has the molecular formula C13H17FN4O and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-fluoro-1-N-[3-(1H-imidazol-2-yl)propyl]-5-methoxybenzene-1,4-diamine.
| Compound Name | 2-fluoro-1-N-[3-(1H-imidazol-2-yl)propyl]-5-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 107259623 |
| Molecular Formula | C13H17FN4O |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-fluoro-1-N-[3-(1H-imidazol-2-yl)propyl]-5-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(NCCCc2ncc[nH]2)c(F)cc1N |
| InChI | InChI=1S/C13H17FN4O/c1-19-12-8-11(9(14)7-10(12)15)16-4-2-3-13-17-5-6-18-13/h5-8,16H,2-4,15H2,1H3,(H,17,18) |
| InChIKey | WRANYXOXMZGJGV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|