C10H18N4S — CID 107267202
N-[(1-methylsulfanylcyclobutyl)methyl]-1-(1-methyltriazol-4-yl)methanamine (PubChem CID 107267202) has the molecular formula C10H18N4S and a molecular weight of 226.35 g/mol. Its IUPAC name is N-[(1-methylsulfanylcyclobutyl)methyl]-1-(1-methyltriazol-4-yl)methanamine.
| Compound Name | N-[(1-methylsulfanylcyclobutyl)methyl]-1-(1-methyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 107267202 |
| Molecular Formula | C10H18N4S |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N-[(1-methylsulfanylcyclobutyl)methyl]-1-(1-methyltriazol-4-yl)methanamine |
| SMILES | CSC1(CNCc2cn(C)nn2)CCC1 |
| InChI | InChI=1S/C10H18N4S/c1-14-7-9(12-13-14)6-11-8-10(15-2)4-3-5-10/h7,11H,3-6,8H2,1-2H3 |
| InChIKey | CCDUQGBNLKKKSB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |