C13H14O2 — CID 10726794
(1R,2S,6S,7R)-7-methoxy-9-methylidenetricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 10726794) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (1R,2S,6S,7R)-7-methoxy-9-methylidenetricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (1R,2S,6S,7R)-7-methoxy-9-methylidenetricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 10726794 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (1R,2S,6S,7R)-7-methoxy-9-methylidenetricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | C=C1C(=O)[C@@]2(OC)C=C[C@@H]1[C@@H]1CC=C[C@@H]12 |
| InChI | InChI=1S/C13H14O2/c1-8-9-6-7-13(15-2,12(8)14)11-5-3-4-10(9)11/h3,5-7,9-11H,1,4H2,2H3/t9-,10-,11-,13+/m0/s1 |
| InChIKey | QVTOWBYRNNSYEY-MRBYEJRBSA-N |
| XLogP | 1.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|