C15H20O2 — CID 10889786
(1S,4S)-1-methoxy-3,3-bis(prop-2-enyl)bicyclo[2.2.2]oct-5-en-2-one (PubChem CID 10889786) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is (1S,4S)-1-methoxy-3,3-bis(prop-2-enyl)bicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,4S)-1-methoxy-3,3-bis(prop-2-enyl)bicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 10889786 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | (1S,4S)-1-methoxy-3,3-bis(prop-2-enyl)bicyclo[2.2.2]oct-5-en-2-one |
| SMILES | C=CCC1(CC=C)C(=O)[C@@]2(OC)C=C[C@@H]1CC2 |
| InChI | InChI=1S/C15H20O2/c1-4-8-14(9-5-2)12-6-10-15(17-3,11-7-12)13(14)16/h4-6,10,12H,1-2,7-9,11H2,3H3/t12-,15-/m1/s1 |
| InChIKey | MZVRFIXOUZERMJ-IUODEOHRSA-N |
| XLogP | 3.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|