C12H16O2 — CID 14270735
7-methoxytricyclo[5.2.2.01,5]undec-5-en-8-one (PubChem CID 14270735) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 7-methoxytricyclo[5.2.2.01,5]undec-5-en-8-one.
| Compound Name | 7-methoxytricyclo[5.2.2.01,5]undec-5-en-8-one |
|---|---|
| PubChem CID | 14270735 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 7-methoxytricyclo[5.2.2.01,5]undec-5-en-8-one |
| SMILES | COC12C=C3CCCC3(CC1)CC2=O |
| InChI | InChI=1S/C12H16O2/c1-14-12-6-5-11(8-10(12)13)4-2-3-9(11)7-12/h7H,2-6,8H2,1H3 |
| InChIKey | HTSRHLPMZFJFEP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|