C13H18O2 — CID 10889056
(1R,8S)-8-methoxytricyclo[6.2.2.01,6]dodec-6-en-9-one (PubChem CID 10889056) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (1R,8S)-8-methoxytricyclo[6.2.2.01,6]dodec-6-en-9-one.
| Compound Name | (1R,8S)-8-methoxytricyclo[6.2.2.01,6]dodec-6-en-9-one |
|---|---|
| PubChem CID | 10889056 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (1R,8S)-8-methoxytricyclo[6.2.2.01,6]dodec-6-en-9-one |
| SMILES | CO[C@]12C=C3CCCC[C@@]3(CC1)CC2=O |
| InChI | InChI=1S/C13H18O2/c1-15-13-7-6-12(9-11(13)14)5-3-2-4-10(12)8-13/h8H,2-7,9H2,1H3/t12-,13+/m1/s1 |
| InChIKey | WHLHMIOKLFUKFT-OLZOCXBDSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|