C10H14O2 — CID 10953888
(1R,4S)-1-methoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 10953888) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1R,4S)-1-methoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1R,4S)-1-methoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 10953888 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1R,4S)-1-methoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | CO[C@@]12C=C(C)[C@@H](CC1)CC2=O |
| InChI | InChI=1S/C10H14O2/c1-7-6-10(12-2)4-3-8(7)5-9(10)11/h6,8H,3-5H2,1-2H3/t8-,10+/m0/s1 |
| InChIKey | ZMSBZAUFTDYOEH-WCBMZHEXSA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|