C16H20O2 — CID 11053897
(1R,2S,6S,7S)-7-methoxy-9-methyl-10-prop-2-enyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one (PubChem CID 11053897) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1R,2S,6S,7S)-7-methoxy-9-methyl-10-prop-2-enyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one.
| Compound Name | (1R,2S,6S,7S)-7-methoxy-9-methyl-10-prop-2-enyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
|---|---|
| PubChem CID | 11053897 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1R,2S,6S,7S)-7-methoxy-9-methyl-10-prop-2-enyltricyclo[5.2.2.02,6]undeca-4,10-dien-8-one |
| SMILES | C=CCC1=C[C@]2(OC)C(=O)C(C)[C@H]1[C@@H]1CC=C[C@@H]12 |
| InChI | InChI=1S/C16H20O2/c1-4-6-11-9-16(18-3)13-8-5-7-12(13)14(11)10(2)15(16)17/h4-5,8-10,12-14H,1,6-7H2,2-3H3/t10?,12-,13+,14-,16-/m1/s1 |
| InChIKey | VVEUTKBBYHYUFK-IMFMJURCSA-N |
| XLogP | 2.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|