C13H22F3NO2 — CID 107270594
2-methyl-3-[[[4-(trifluoromethyl)cyclohexyl]amino]methyl]oxolan-3-ol (PubChem CID 107270594) has the molecular formula C13H22F3NO2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 2-methyl-3-[[[4-(trifluoromethyl)cyclohexyl]amino]methyl]oxolan-3-ol.
| Compound Name | 2-methyl-3-[[[4-(trifluoromethyl)cyclohexyl]amino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 107270594 |
| Molecular Formula | C13H22F3NO2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 2-methyl-3-[[[4-(trifluoromethyl)cyclohexyl]amino]methyl]oxolan-3-ol |
| SMILES | CC1OCCC1(O)CNC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H22F3NO2/c1-9-12(18,6-7-19-9)8-17-11-4-2-10(3-5-11)13(14,15)16/h9-11,17-18H,2-8H2,1H3 |
| InChIKey | DIAQRKCGZCTCFS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |