C13H22O2 — CID 10727185
1-[(1S,3aS,5R,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 10727185) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is 1-[(1S,3aS,5R,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[(1S,3aS,5R,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 10727185 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1-[(1S,3aS,5R,6aR)-5-hydroxy-1,2,3,3a,4,5,6,6a-octahydropentalen-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)[C@H]1CC[C@H]2C[C@@H](O)C[C@H]21 |
| InChI | InChI=1S/C13H22O2/c1-13(2,3)12(15)10-5-4-8-6-9(14)7-11(8)10/h8-11,14H,4-7H2,1-3H3/t8-,9+,10-,11+/m0/s1 |
| InChIKey | BEHLNDQMQSMEJM-ZRUFSTJUSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |