C12H21NO3 — CID 66669394
(3aS,6aR)-3-tert-butyl-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 66669394) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is (3aS,6aR)-3-tert-butyl-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3aS,6aR)-3-tert-butyl-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 66669394 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (3aS,6aR)-3-tert-butyl-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | CC(C)(C)C1[C@H]2CC(O)C[C@H]2CN1C(=O)O |
| InChI | InChI=1S/C12H21NO3/c1-12(2,3)10-9-5-8(14)4-7(9)6-13(10)11(15)16/h7-10,14H,4-6H2,1-3H3,(H,15,16)/t7-,8?,9-,10?/m0/s1 |
| InChIKey | LSGKAAMWFPSCSY-FMLYDFSMSA-N |
| XLogP | 1.78 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |