C13H21NO2 — CID 54028240
(3S,3aS)-3-tert-butyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid (PubChem CID 54028240) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (3S,3aS)-3-tert-butyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid.
| Compound Name | (3S,3aS)-3-tert-butyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 54028240 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (3S,3aS)-3-tert-butyl-5-methylidene-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylic acid |
| SMILES | C=C1CC2CN(C(=O)O)[C@H](C(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C13H21NO2/c1-8-5-9-7-14(12(15)16)11(10(9)6-8)13(2,3)4/h9-11H,1,5-7H2,2-4H3,(H,15,16)/t9?,10-,11-/m0/s1 |
| InChIKey | LDSRNFJEULBBOL-DVRYWGNFSA-N |
| XLogP | 2.98 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|