C13H27NOS — CID 107271920
3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]pentan-3-ol (PubChem CID 107271920) has the molecular formula C13H27NOS and a molecular weight of 245.43 g/mol. Its IUPAC name is 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]pentan-3-ol.
| Compound Name | 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]pentan-3-ol |
|---|---|
| PubChem CID | 107271920 |
| Molecular Formula | C13H27NOS |
| Molecular Weight | 245.43 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 3-[(7,7-dimethyl-1,4-thiazepan-4-yl)methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CN1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C13H27NOS/c1-5-13(15,6-2)11-14-8-7-12(3,4)16-10-9-14/h15H,5-11H2,1-4H3 |
| InChIKey | QSGSSZZBMDOZQM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |