C12H25NOS — CID 107271898
1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-methylbutan-2-ol (PubChem CID 107271898) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-methylbutan-2-ol.
| Compound Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 107271898 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 1-(7,7-dimethyl-1,4-thiazepan-4-yl)-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)CN1CCSC(C)(C)CC1 |
| InChI | InChI=1S/C12H25NOS/c1-5-12(4,14)10-13-7-6-11(2,3)15-9-8-13/h14H,5-10H2,1-4H3 |
| InChIKey | CPKMXJOJRPQIKQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |