C8H11ClN4O — CID 10727399
1-(2-chloroethyl)-3-(pyridin-4-ylamino)urea (PubChem CID 10727399) has the molecular formula C8H11ClN4O and a molecular weight of 214.66 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-(pyridin-4-ylamino)urea.
| Compound Name | 1-(2-chloroethyl)-3-(pyridin-4-ylamino)urea |
|---|---|
| PubChem CID | 10727399 |
| Molecular Formula | C8H11ClN4O |
| Molecular Weight | 214.66 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 1-(2-chloroethyl)-3-(pyridin-4-ylamino)urea |
| SMILES | O=C(NCCCl)NNc1ccncc1 |
| InChI | InChI=1S/C8H11ClN4O/c9-3-6-11-8(14)13-12-7-1-4-10-5-2-7/h1-2,4-5H,3,6H2,(H,10,12)(H2,11,13,14) |
| InChIKey | MGZOKQRUFOWJIE-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.66 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|