C16H15BrN2OS — CID 107277712
2-bromo-4-(2,3-dihydro-1-benzofuran-2-ylmethylamino)benzenecarbothioamide (PubChem CID 107277712) has the molecular formula C16H15BrN2OS and a molecular weight of 363.28 g/mol. Its IUPAC name is 2-bromo-4-(2,3-dihydro-1-benzofuran-2-ylmethylamino)benzenecarbothioamide.
| Compound Name | 2-bromo-4-(2,3-dihydro-1-benzofuran-2-ylmethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107277712 |
| Molecular Formula | C16H15BrN2OS |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-bromo-4-(2,3-dihydro-1-benzofuran-2-ylmethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCC2Cc3ccccc3O2)cc1Br |
| InChI | InChI=1S/C16H15BrN2OS/c17-14-8-11(5-6-13(14)16(18)21)19-9-12-7-10-3-1-2-4-15(10)20-12/h1-6,8,12,19H,7,9H2,(H2,18,21) |
| InChIKey | NIVZLGNSVSEZID-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|