C11H11BrF3NO3 — CID 107285600
2-[2-[5-bromo-2-(trifluoromethyl)anilino]ethoxy]acetic acid (PubChem CID 107285600) has the molecular formula C11H11BrF3NO3 and a molecular weight of 342.11 g/mol. Its IUPAC name is 2-[2-[5-bromo-2-(trifluoromethyl)anilino]ethoxy]acetic acid.
| Compound Name | 2-[2-[5-bromo-2-(trifluoromethyl)anilino]ethoxy]acetic acid |
|---|---|
| PubChem CID | 107285600 |
| Molecular Formula | C11H11BrF3NO3 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-[2-[5-bromo-2-(trifluoromethyl)anilino]ethoxy]acetic acid |
| SMILES | O=C(O)COCCNc1cc(Br)ccc1C(F)(F)F |
| InChI | InChI=1S/C11H11BrF3NO3/c12-7-1-2-8(11(13,14)15)9(5-7)16-3-4-19-6-10(17)18/h1-2,5,16H,3-4,6H2,(H,17,18) |
| InChIKey | YQOVNFBYBKAWCN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|